CAS 22865-52-7 is the registry number for 4-((4-methylphenyl)sulfanyl)aniline. Offered by: Biosynth. Available pack sizes: 5000mg.
4-(4-methylphenyl)sulfanylaniline (CAS 22865-52-7) is a chemical compound with the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. IUPAC name: 4-(4-methylphenyl)sulfanylaniline. InChIKey: AJSXOVAGVRPACZ-UHFFFAOYSA-N.
| Molecular formula | C13H13NS |
|---|---|
| Molecular weight | 215.32 g/mol |
| IUPAC name | 4-(4-methylphenyl)sulfanylaniline |
| InChIKey | AJSXOVAGVRPACZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)