CAS 2287237-26-5 appears in our catalog under these names: (3S)-3-Amino-3-cyclopropyl-2,2-difluoropropan-1-ol hydrochloride, (S)-3-Amino-3-cyclopropyl-2,2-difluoropropan-1-ol hydrochloride, 95%, 95%, (S)-3-Amino-3-cyclopropyl-2,2-difluoropropan-1-ol hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 5g, 100mg, 250mg, 500mg, 1g.
(3S)-3-amino-3-cyclopropyl-2,2-difluoropropan-1-ol;hydrochloride (CAS 2287237-26-5) is a chemical compound with the molecular formula C6H12ClF2NO and a molecular weight of 187.61 g/mol. IUPAC name: (3S)-3-amino-3-cyclopropyl-2,2-difluoropropan-1-ol;hydrochloride. InChIKey: MVSFJPVZJQSEQU-JEDNCBNOSA-N.
| Molecular formula | C6H12ClF2NO |
|---|---|
| Molecular weight | 187.61 g/mol |
| IUPAC name | (3S)-3-amino-3-cyclopropyl-2,2-difluoropropan-1-ol;hydrochloride |
| InChIKey | MVSFJPVZJQSEQU-JEDNCBNOSA-N |
| SMILES | C1CC1[C@@H](C(CO)(F)F)N.Cl |
Computed by PubChem (NCBI)