CAS 2287238-03-1 is the registry number for (4R)-4-(Propan-2-yl)-1λâ¶,2,5-thiadiazolidine-1,1,3-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4R)-1,1-dioxo-4-propan-2-yl-1,2,5-thiadiazolidin-3-one (CAS 2287238-03-1) is a chemical compound with the molecular formula C5H10N2O3S and a molecular weight of 178.21 g/mol. IUPAC name: (4R)-1,1-dioxo-4-propan-2-yl-1,2,5-thiadiazolidin-3-one. InChIKey: ARGDYBLGWYGDMM-SCSAIBSYSA-N.
| Molecular formula | C5H10N2O3S |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | (4R)-1,1-dioxo-4-propan-2-yl-1,2,5-thiadiazolidin-3-one |
| InChIKey | ARGDYBLGWYGDMM-SCSAIBSYSA-N |
| SMILES | CC(C)[C@@H]1C(=O)NS(=O)(=O)N1 |
Computed by PubChem (NCBI)