Products 2287273-52-1
CAS 2287273-52-1 is the registry number for tert-Butyl 1,2,5-triazaspiro[2.3]hex-1-ene-5-carboxylate, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 1,2,5-triazaspiro[2.3]hex-1-ene-5-carboxylate (CAS 2287273-52-1) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: tert-butyl 1,2,5-triazaspiro[2.3]hex-1-ene-5-carboxylate. InChIKey: YBNZTFCZKNIWJR-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | tert-butyl 1,2,5-triazaspiro[2.3]hex-1-ene-5-carboxylate |
| InChIKey | YBNZTFCZKNIWJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)N=N2 |
Computed by PubChem (NCBI)