Products 2287282-11-3
CAS 2287282-11-3 is the registry number for [3-(4-methylphenyl)bicyclo[1.1.1]pentan-1-yl]methanol, >95%. Offered by: Chemat. Available pack sizes: 100mg.
[3-(4-methylphenyl)-1-bicyclo[1.1.1]pentanyl]methanol (CAS 2287282-11-3) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: [3-(4-methylphenyl)-1-bicyclo[1.1.1]pentanyl]methanol. InChIKey: RJSMWUVZIOEYEJ-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | [3-(4-methylphenyl)-1-bicyclo[1.1.1]pentanyl]methanol |
| InChIKey | RJSMWUVZIOEYEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C23CC(C2)(C3)CO |
Computed by PubChem (NCBI)