CAS 2287298-70-6 is the registry number for tert-Butyl 2-sulfamoylpropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2-sulfamoylpropanoate (CAS 2287298-70-6) is a chemical compound with the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. IUPAC name: tert-butyl 2-sulfamoylpropanoate. InChIKey: VTOSJWSUNDYYBD-UHFFFAOYSA-N.
| Molecular formula | C7H15NO4S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | tert-butyl 2-sulfamoylpropanoate |
| InChIKey | VTOSJWSUNDYYBD-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC(C)(C)C)S(=O)(=O)N |
Computed by PubChem (NCBI)