Products 2287298-70-6

CAS 2287298-70-6 is the registry number for tert-Butyl 2-sulfamoylpropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-sulfamoylpropanoate (CAS 2287298-70-6) is a chemical compound with the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. IUPAC name: tert-butyl 2-sulfamoylpropanoate. InChIKey: VTOSJWSUNDYYBD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15NO4S
Molecular weight209.27 g/mol
IUPAC nametert-butyl 2-sulfamoylpropanoate
InChIKeyVTOSJWSUNDYYBD-UHFFFAOYSA-N
SMILESCC(C(=O)OC(C)(C)C)S(=O)(=O)N

Computed by PubChem (NCBI)