CAS 2287300-55-2 is the registry number for 9,10-Dihydroanthracen-9-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
9,10-dihydroanthracen-9-amine;hydrochloride (CAS 2287300-55-2) is a chemical compound with the molecular formula C14H14ClN and a molecular weight of 231.72 g/mol. IUPAC name: 9,10-dihydroanthracen-9-amine;hydrochloride. InChIKey: BIJHYZBOMSGDCZ-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 9,10-dihydroanthracen-9-amine;hydrochloride |
| InChIKey | BIJHYZBOMSGDCZ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(C3=CC=CC=C31)N.Cl |
Computed by PubChem (NCBI)