CAS 2287300-58-5 is the registry number for 2H,3H,4H-1λâ¶-Thieno(3,2-b)(1,4)thiazine-1,1-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,4-dihydro-2H-thieno[3,2-b][1,4]thiazine 1,1-dioxide (CAS 2287300-58-5) is a chemical compound with the molecular formula C6H7NO2S2 and a molecular weight of 189.3 g/mol. IUPAC name: 3,4-dihydro-2H-thieno[3,2-b][1,4]thiazine 1,1-dioxide. InChIKey: BDOWXLPRMPXWHL-UHFFFAOYSA-N.
| Molecular formula | C6H7NO2S2 |
|---|---|
| Molecular weight | 189.3 g/mol |
| IUPAC name | 3,4-dihydro-2H-thieno[3,2-b][1,4]thiazine 1,1-dioxide |
| InChIKey | BDOWXLPRMPXWHL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C(N1)SC=C2 |
Computed by PubChem (NCBI)