Products 2287315-92-6
CAS 2287315-92-6 is the registry number for {3-cyclohexylbicyclo[1.1.1]pentan-1-yl}methanol, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(3-cyclohexyl-1-bicyclo[1.1.1]pentanyl)methanol (CAS 2287315-92-6) is a chemical compound with the molecular formula C12H20O and a molecular weight of 180.29 g/mol. IUPAC name: (3-cyclohexyl-1-bicyclo[1.1.1]pentanyl)methanol. InChIKey: YAZQPCDZCSEFIN-UHFFFAOYSA-N.
| Molecular formula | C12H20O |
|---|---|
| Molecular weight | 180.29 g/mol |
| IUPAC name | (3-cyclohexyl-1-bicyclo[1.1.1]pentanyl)methanol |
| InChIKey | YAZQPCDZCSEFIN-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C23CC(C2)(C3)CO |
Computed by PubChem (NCBI)