CAS 2287318-89-0 appears in our catalog under these names: 4-(Trifluoromethyl)-2-oxabicyclo(2.1.1)hexane-1-carboxylic acid, 98%, 4-(Trifluoromethyl)-2-oxabicyclo(2.1.1)hexane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 50mg, 25mg.
4-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid (CAS 2287318-89-0) is a chemical compound with the molecular formula C7H7F3O3 and a molecular weight of 196.12 g/mol. IUPAC name: 4-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid. InChIKey: BPSXYCOUTNFRPG-UHFFFAOYSA-N.
| Molecular formula | C7H7F3O3 |
|---|---|
| Molecular weight | 196.12 g/mol |
| IUPAC name | 4-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid |
| InChIKey | BPSXYCOUTNFRPG-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(OC2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)