CAS 2759480-17-4 is the registry number for rel-(1R,2R)-4-Oxo-2-(trifluoromethyl)cyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-4-oxo-2-(trifluoromethyl)cyclopentane-1-carboxylic acid (CAS 2759480-17-4) is a chemical compound with the molecular formula C7H7F3O3 and a molecular weight of 196.12 g/mol. IUPAC name: trans-(1R,2R)-4-oxo-2-(trifluoromethyl)cyclopentane-1-carboxylic acid. InChIKey: UTZCOSPGLOOCAS-RFZPGFLSSA-N.
| Molecular formula | C7H7F3O3 |
|---|---|
| Molecular weight | 196.12 g/mol |
| IUPAC name | trans-(1R,2R)-4-oxo-2-(trifluoromethyl)cyclopentane-1-carboxylic acid |
| InChIKey | UTZCOSPGLOOCAS-RFZPGFLSSA-N |
| SMILES | C1[C@H]([C@@H](CC1=O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)