Products 2624134-57-0
CAS 2624134-57-0 appears in our catalog under these names: 1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid, 97%, 1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 100mg, 50mg.
1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid (CAS 2624134-57-0) is a chemical compound with the molecular formula C7H7F3O3 and a molecular weight of 196.12 g/mol. IUPAC name: 1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid. InChIKey: BYWBQQUNSMQHQV-UHFFFAOYSA-N.
| Molecular formula | C7H7F3O3 |
|---|---|
| Molecular weight | 196.12 g/mol |
| IUPAC name | 1-(trifluoromethyl)-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid |
| InChIKey | BYWBQQUNSMQHQV-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(OC2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)