Products 2287343-66-0

CAS 2287343-66-0 is the registry number for 4-[(2-Aminoethyl)amino]-3-nitrobenzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

4-(2-aminoethylamino)-3-nitrobenzoic acid;hydrochloride (CAS 2287343-66-0) is a chemical compound with the molecular formula C9H12ClN3O4 and a molecular weight of 261.66 g/mol. IUPAC name: 4-(2-aminoethylamino)-3-nitrobenzoic acid;hydrochloride. InChIKey: KXIARYCZXQGYNO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClN3O4
Molecular weight261.66 g/mol
IUPAC name4-(2-aminoethylamino)-3-nitrobenzoic acid;hydrochloride
InChIKeyKXIARYCZXQGYNO-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])NCCN.Cl

Computed by PubChem (NCBI)