CAS 32659-31-7 appears in our catalog under these names: Cytarabine Impurity 7, Cytarabine Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-1-[(2R,3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one (CAS 32659-31-7) is a chemical compound with the molecular formula C9H12ClN3O4 and a molecular weight of 261.66 g/mol. IUPAC name: 4-amino-1-[(2R,3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one. InChIKey: BPGIZMWGUQVFSE-CCXZUQQUSA-N.
| Molecular formula | C9H12ClN3O4 |
|---|---|
| Molecular weight | 261.66 g/mol |
| IUPAC name | 4-amino-1-[(2R,3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
| InChIKey | BPGIZMWGUQVFSE-CCXZUQQUSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@H]([C@@H]([C@H](O2)CCl)O)O |
Computed by PubChem (NCBI)