CAS 57939-59-0 appears in our catalog under these names: Ornidazole Impurity 25, Ornidazole Impurity 45, 1-Chloro-3-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-yl acetate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
[1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-yl] acetate (CAS 57939-59-0) is a chemical compound with the molecular formula C9H12ClN3O4 and a molecular weight of 261.66 g/mol. IUPAC name: [1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-yl] acetate. InChIKey: UZGLGTONLZJBNR-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O4 |
|---|---|
| Molecular weight | 261.66 g/mol |
| IUPAC name | [1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-yl] acetate |
| InChIKey | UZGLGTONLZJBNR-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CC(CCl)OC(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)