Products 2287346-23-8
CAS 2287346-23-8 is the registry number for (1R,3R)-3-((tert-Butoxycarbonyl)amino)-1-methylcyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,3R)-1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 2287346-23-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: cis-(1R,3R)-1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: CUHLFFVFLWVECZ-PRHODGIISA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | cis-(1R,3R)-1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | CUHLFFVFLWVECZ-PRHODGIISA-N |
| SMILES | C[C@]1(CC[C@H](C1)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)