CAS 2288740-66-7 is the registry number for Pantoprazole Impurity O. Offered by: Chemat Brand. Available pack sizes: on request.
(3,4-dimethoxy-1-oxidopyridin-1-ium-2-yl)methanol (CAS 2288740-66-7) is a chemical compound with the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. IUPAC name: (3,4-dimethoxy-1-oxidopyridin-1-ium-2-yl)methanol. InChIKey: XGNHURPBHCMZGE-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | (3,4-dimethoxy-1-oxidopyridin-1-ium-2-yl)methanol |
| InChIKey | XGNHURPBHCMZGE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=[N+](C=C1)[O-])CO)OC |
Computed by PubChem (NCBI)