CAS 22901-00-4 appears in our catalog under these names: Benzothiazole, 2-(2-bromophenyl)-, 97%, 2-(2-Bromophenyl)benzo(d)thiazole, 97%, 2-(2-Bromophenyl)benzo[d]thiazole. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-(2-bromophenyl)-1,3-benzothiazole (CAS 22901-00-4) is a chemical compound with the molecular formula C13H8BrNS and a molecular weight of 290.18 g/mol. IUPAC name: 2-(2-bromophenyl)-1,3-benzothiazole. InChIKey: QWRINZRJGGMRTJ-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNS |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 2-(2-bromophenyl)-1,3-benzothiazole |
| InChIKey | QWRINZRJGGMRTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=CC=CC=C3S2)Br |
Computed by PubChem (NCBI)