CAS 36247-07-1 is the registry number for 7-Bromo-2-phenylbenzo(d)thiazole, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
7-bromo-2-phenyl-1,3-benzothiazole (CAS 36247-07-1) is a chemical compound with the molecular formula C13H8BrNS and a molecular weight of 290.18 g/mol. IUPAC name: 7-bromo-2-phenyl-1,3-benzothiazole. InChIKey: SZANSBAGZIPOGX-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNS |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 7-bromo-2-phenyl-1,3-benzothiazole |
| InChIKey | SZANSBAGZIPOGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(S2)C(=CC=C3)Br |
Computed by PubChem (NCBI)