Products 557793-46-1
CAS 557793-46-1 is the registry number for 2-(Benzo(b)thiophen-2-yl)-5-bromopyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2-(1-benzothiophen-2-yl)-5-bromopyridine (CAS 557793-46-1) is a chemical compound with the molecular formula C13H8BrNS and a molecular weight of 290.18 g/mol. IUPAC name: 2-(1-benzothiophen-2-yl)-5-bromopyridine. InChIKey: LJLCJXBZJXNSLH-UHFFFAOYSA-N.
| Molecular formula | C13H8BrNS |
|---|---|
| Molecular weight | 290.18 g/mol |
| IUPAC name | 2-(1-benzothiophen-2-yl)-5-bromopyridine |
| InChIKey | LJLCJXBZJXNSLH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C3=NC=C(C=C3)Br |
Computed by PubChem (NCBI)