Products 2292639-39-3
CAS 2292639-39-3 is the registry number for Methyl α-[[(1,1-dimethylethoxy)carbonyl]amino]-3,3-difluorocyclobutaneacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-(3,3-difluorocyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CAS 2292639-39-3) is a chemical compound with the molecular formula C12H19F2NO4 and a molecular weight of 279.28 g/mol. IUPAC name: methyl 2-(3,3-difluorocyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate. InChIKey: KYFMJIAUCVRMGP-UHFFFAOYSA-N.
| Molecular formula | C12H19F2NO4 |
|---|---|
| Molecular weight | 279.28 g/mol |
| IUPAC name | methyl 2-(3,3-difluorocyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| InChIKey | KYFMJIAUCVRMGP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1CC(C1)(F)F)C(=O)OC |
Computed by PubChem (NCBI)