CAS 22934-99-2 appears in our catalog under these names: Desmethoxy Centaureidin, Desmethoxycentaureidin, Desmethoxycentaureidin, ≥90%, ≥90%, Demethoxycentaureidin. Offered by: Chemat Brand, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 5mg, 1mg, 10mg, 50mg, 25mg, 20mg, 1 mg.
5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one (CAS 22934-99-2) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one. InChIKey: VCWFILUULGOFCD-UHFFFAOYSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one |
| InChIKey | VCWFILUULGOFCD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C(=C3O)OC)O)O |
Computed by PubChem (NCBI)