CAS 29536-41-2 is the registry number for Eupalitin. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1 mg, 5 mg.
3,5-dihydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxychromen-4-one (CAS 29536-41-2) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: 3,5-dihydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxychromen-4-one. InChIKey: KWMAWXWUGIEVDG-UHFFFAOYSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 3,5-dihydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxychromen-4-one |
| InChIKey | KWMAWXWUGIEVDG-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)OC |
Computed by PubChem (NCBI)