CAS 25782-24-5 is the registry number for Nuchensin. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
5,6-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxychromen-4-one (CAS 25782-24-5) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: 5,6-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxychromen-4-one. InChIKey: GCKIPZDMMOATHU-UHFFFAOYSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 5,6-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxychromen-4-one |
| InChIKey | GCKIPZDMMOATHU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)O)O)O |
Computed by PubChem (NCBI)