Products 229614-37-3
CAS 229614-37-3 is the registry number for De-guanidine Peramivir. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentane-1-carboxylic acid (CAS 229614-37-3) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: (1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentane-1-carboxylic acid. InChIKey: LUBKBQAAWUOYOW-CKIKVBCHSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | (1S,2S,3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentane-1-carboxylic acid |
| InChIKey | LUBKBQAAWUOYOW-CKIKVBCHSA-N |
| SMILES | CCC(CC)[C@@H]([C@H]1[C@@H](C[C@@H]([C@H]1O)C(=O)O)N)NC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
De-guanidine Peramivir