Products 2296675-88-0
CAS 2296675-88-0 is the registry number for 1-nitro-4-(1-(trifluoromethyl)cyclopropyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
1-nitro-4-[1-(trifluoromethyl)cyclopropyl]benzene (CAS 2296675-88-0) is a chemical compound with the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. IUPAC name: 1-nitro-4-[1-(trifluoromethyl)cyclopropyl]benzene. InChIKey: QGFGJOJKHPCNEL-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO2 |
|---|---|
| Molecular weight | 231.17 g/mol |
| IUPAC name | 1-nitro-4-[1-(trifluoromethyl)cyclopropyl]benzene |
| InChIKey | QGFGJOJKHPCNEL-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)