CAS 2300752-10-5 is the registry number for Noradrenaline (Norepinephrine) Impurity 79. Offered by: Chemat Brand. Available pack sizes: on request.
2-(benzylamino)-1-(3-hydroxyphenyl)ethanone (CAS 2300752-10-5) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 2-(benzylamino)-1-(3-hydroxyphenyl)ethanone. InChIKey: DAXFSNTWXVQINK-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-(benzylamino)-1-(3-hydroxyphenyl)ethanone |
| InChIKey | DAXFSNTWXVQINK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCC(=O)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)