Products 2301832-06-2
CAS 2301832-06-2 appears in our catalog under these names: 6-Bromo-8-chloro-2-methylimidazo(1,2-a)pyridine, 6-Bromo-8-chloro-2-methylimidazo[1,2-a]pyridine, 95%, 6-Bromo-8-chloro-2-methylimidazo[1,2-a]pyridine, 98%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
6-bromo-8-chloro-2-methylimidazo[1,2-a]pyridine (CAS 2301832-06-2) is a chemical compound with the molecular formula C8H6BrClN2 and a molecular weight of 245.50 g/mol. IUPAC name: 6-bromo-8-chloro-2-methylimidazo[1,2-a]pyridine. InChIKey: VYMSGTAZBSRLTK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN2 |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | 6-bromo-8-chloro-2-methylimidazo[1,2-a]pyridine |
| InChIKey | VYMSGTAZBSRLTK-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(C=C(C2=N1)Cl)Br |
Computed by PubChem (NCBI)