CAS 23019-61-6 is the registry number for 1-Benzyl-4-carboxy-pyridinium Ethyl Ester Bromide. Offered by: TRC. Available pack sizes: 500mg, 5g.
Ethyl 1-benzylpyridin-1-ium-4-carboxylate bromide (CAS 23019-61-6) is a chemical compound with the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. IUPAC name: ethyl 1-benzylpyridin-1-ium-4-carboxylate bromide. InChIKey: QDURSZTWSNZWLI-UHFFFAOYSA-M.
| Molecular formula | C15H16BrNO2 |
|---|---|
| Molecular weight | 322.20 g/mol |
| IUPAC name | ethyl 1-benzylpyridin-1-ium-4-carboxylate bromide |
| InChIKey | QDURSZTWSNZWLI-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=CC=[N+](C=C1)CC2=CC=CC=C2.[Br-] |
Computed by PubChem (NCBI)