Products 23019-61-6

CAS 23019-61-6 is the registry number for 1-Benzyl-4-carboxy-pyridinium Ethyl Ester Bromide. Offered by: TRC. Available pack sizes: 500mg, 5g.

Structural formula: {0} (CAS {1})

Ethyl 1-benzylpyridin-1-ium-4-carboxylate bromide (CAS 23019-61-6) is a chemical compound with the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. IUPAC name: ethyl 1-benzylpyridin-1-ium-4-carboxylate bromide. InChIKey: QDURSZTWSNZWLI-UHFFFAOYSA-M.

Identity
Molecular formulaC15H16BrNO2
Molecular weight322.20 g/mol
IUPAC nameethyl 1-benzylpyridin-1-ium-4-carboxylate bromide
InChIKeyQDURSZTWSNZWLI-UHFFFAOYSA-M
SMILESCCOC(=O)C1=CC=[N+](C=C1)CC2=CC=CC=C2.[Br-]

Computed by PubChem (NCBI)