CAS 333796-54-6 is the registry number for Formoterol Impurity 58. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3-amino-4-phenylmethoxyphenyl)-2-bromoethanol (CAS 333796-54-6) is a chemical compound with the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. IUPAC name: (1R)-1-(3-amino-4-phenylmethoxyphenyl)-2-bromoethanol. InChIKey: AOKALCBWBYJIDM-AWEZNQCLSA-N.
| Molecular formula | C15H16BrNO2 |
|---|---|
| Molecular weight | 322.20 g/mol |
| IUPAC name | (1R)-1-(3-amino-4-phenylmethoxyphenyl)-2-bromoethanol |
| InChIKey | AOKALCBWBYJIDM-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)[C@H](CBr)O)N |
Computed by PubChem (NCBI)