Products 2302806-63-7

CAS 2302806-63-7 is the registry number for 3-(2,4-Dibromophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2,4-dibromophenyl)-2-oxopropanoic acid (CAS 2302806-63-7) is a chemical compound with the molecular formula C9H6Br2O3 and a molecular weight of 321.95 g/mol. IUPAC name: 3-(2,4-dibromophenyl)-2-oxopropanoic acid. InChIKey: LNXHIBCTDHORQY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Br2O3
Molecular weight321.95 g/mol
IUPAC name3-(2,4-dibromophenyl)-2-oxopropanoic acid
InChIKeyLNXHIBCTDHORQY-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)Br)CC(=O)C(=O)O

Computed by PubChem (NCBI)