Products 866086-92-2

CAS 866086-92-2 is the registry number for 3-(3,4-Dibromophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3,4-dibromophenyl)-2-oxopropanoic acid (CAS 866086-92-2) is a chemical compound with the molecular formula C9H6Br2O3 and a molecular weight of 321.95 g/mol. IUPAC name: 3-(3,4-dibromophenyl)-2-oxopropanoic acid. InChIKey: VUAAJFOVWLNPKM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6Br2O3
Molecular weight321.95 g/mol
IUPAC name3-(3,4-dibromophenyl)-2-oxopropanoic acid
InChIKeyVUAAJFOVWLNPKM-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CC(=O)C(=O)O)Br)Br

Computed by PubChem (NCBI)