CAS 74849-10-8 is the registry number for 2,6-Dibromo-4-formylphenyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,6-dibromo-4-formylphenyl) acetate (CAS 74849-10-8) is a chemical compound with the molecular formula C9H6Br2O3 and a molecular weight of 321.95 g/mol. IUPAC name: (2,6-dibromo-4-formylphenyl) acetate. InChIKey: BYPSFDNHNSBNML-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O3 |
|---|---|
| Molecular weight | 321.95 g/mol |
| IUPAC name | (2,6-dibromo-4-formylphenyl) acetate |
| InChIKey | BYPSFDNHNSBNML-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1Br)C=O)Br |
Computed by PubChem (NCBI)