CAS 23046-69-7 appears in our catalog under these names: 6-Bromo-2,3,4,9-tetrahydro-1H-pyrido(3,4-b)indole, 95+%, 6-Bromo-1H,2H,3H,4H,9H-pyrido(3,4-b)indole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (CAS 23046-69-7) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 6-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole. InChIKey: WUTVTUWSFMYRJK-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 6-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| InChIKey | WUTVTUWSFMYRJK-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)