CAS 2304635-11-6 appears in our catalog under these names: 4,4,5,5-tetramethyl-2-(7-methylnaphthalen-1-yl)-1,3,2-dioxaborolane, 97%, 97%, 4,4,5,5-TETRAMETHYL-2-(7-METHYLNAPHTHALEN-1-YL)-1,3,2-DIOXABOROLANE, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4,4,5,5-tetramethyl-2-(7-methylnaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 2304635-11-6) is a chemical compound with the molecular formula C17H21BO2 and a molecular weight of 268.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(7-methylnaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: KTPXEJRTRUKHBW-UHFFFAOYSA-N.
| Molecular formula | C17H21BO2 |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(7-methylnaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | KTPXEJRTRUKHBW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=C(C=CC3=CC=C2)C |
Computed by PubChem (NCBI)