Products 2454397-99-8
CAS 2454397-99-8 is the registry number for 4,4,5,5-Tetramethyl-2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
4,4,5,5-tetramethyl-2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 2454397-99-8) is a chemical compound with the molecular formula C17H21BO2 and a molecular weight of 268.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: OUFWQGLUAVLHDA-UHFFFAOYSA-N.
| Molecular formula | C17H21BO2 |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(8-methylnaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | OUFWQGLUAVLHDA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=CC3=CC=C2)C |
Computed by PubChem (NCBI)