CAS 2304978-51-4 appears in our catalog under these names: 2-(2-(3-Fluorophenyl)-2-oxoethyl)malononitrile, 95%, 95%, 2-(2-(3-Fluorophenyl)-2-oxoethyl)malononitrile, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-[2-(3-fluorophenyl)-2-oxoethyl]propanedinitrile (CAS 2304978-51-4) is a chemical compound with the molecular formula C11H7FN2O and a molecular weight of 202.18 g/mol. IUPAC name: 2-[2-(3-fluorophenyl)-2-oxoethyl]propanedinitrile. InChIKey: REYNTASKUYMXDO-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 2-[2-(3-fluorophenyl)-2-oxoethyl]propanedinitrile |
| InChIKey | REYNTASKUYMXDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)CC(C#N)C#N |
Computed by PubChem (NCBI)