CAS 2305251-63-0 is the registry number for (2-(Aminomethyl)-6,6-difluorospiro(3.3)heptan-2-yl)methanol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[6-(aminomethyl)-2,2-difluorospiro[3.3]heptan-6-yl]methanol;hydrochloride (CAS 2305251-63-0) is a chemical compound with the molecular formula C9H16ClF2NO and a molecular weight of 227.68 g/mol. IUPAC name: [6-(aminomethyl)-2,2-difluorospiro[3.3]heptan-6-yl]methanol;hydrochloride. InChIKey: WSPJAIWHUFXSNH-UHFFFAOYSA-N.
| Molecular formula | C9H16ClF2NO |
|---|---|
| Molecular weight | 227.68 g/mol |
| IUPAC name | [6-(aminomethyl)-2,2-difluorospiro[3.3]heptan-6-yl]methanol;hydrochloride |
| InChIKey | WSPJAIWHUFXSNH-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(CN)CO)CC(C2)(F)F.Cl |
Computed by PubChem (NCBI)