Products 2309465-90-3

CAS 2309465-90-3 is the registry number for 9,9-Difluoro-1-oxa-4-azaspiro[5.5]undecane hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

9,9-difluoro-1-oxa-4-azaspiro[5.5]undecane;hydrochloride (CAS 2309465-90-3) is a chemical compound with the molecular formula C9H16ClF2NO and a molecular weight of 227.68 g/mol. IUPAC name: 9,9-difluoro-1-oxa-4-azaspiro[5.5]undecane;hydrochloride. InChIKey: UTBMOUALEBOZQT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClF2NO
Molecular weight227.68 g/mol
IUPAC name9,9-difluoro-1-oxa-4-azaspiro[5.5]undecane;hydrochloride
InChIKeyUTBMOUALEBOZQT-UHFFFAOYSA-N
SMILESC1CC(CCC12CNCCO2)(F)F.Cl

Computed by PubChem (NCBI)