CAS 2928513-42-0 is the registry number for 1,1-Difluoro-6-oxaspiro[4.5]decan-9-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-difluoro-6-oxaspiro[4.5]decan-9-amine;hydrochloride (CAS 2928513-42-0) is a chemical compound with the molecular formula C9H16ClF2NO and a molecular weight of 227.68 g/mol. IUPAC name: 4,4-difluoro-6-oxaspiro[4.5]decan-9-amine;hydrochloride. InChIKey: QBMZQUMEYMVIKN-UHFFFAOYSA-N.
| Molecular formula | C9H16ClF2NO |
|---|---|
| Molecular weight | 227.68 g/mol |
| IUPAC name | 4,4-difluoro-6-oxaspiro[4.5]decan-9-amine;hydrochloride |
| InChIKey | QBMZQUMEYMVIKN-UHFFFAOYSA-N |
| SMILES | C1CC2(CC(CCO2)N)C(C1)(F)F.Cl |
Computed by PubChem (NCBI)