CAS 23056-36-2 appears in our catalog under these names: 2-Chloro-4-nitropyridine 98%, 2-CHLORO-4-NITROPYRIDINE, 97%, 2-Chloro-4-nitropyridine, 99.85%, 2-Chloro-4-nitropyridine, 98%, 2-Chloro-4-nitropyridine, >98.0%(GC). Offered by: Ambeed, Sigma-Aldrich, MedChemExpress, Fluorochem, TCI. Available pack sizes: 1000g, 5g, 10g, 25g, 100g, 500g, 25 g, 10 g.
2-chloro-4-nitropyridine (CAS 23056-36-2) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 2-chloro-4-nitropyridine. InChIKey: LIEPVGBDUYKPLC-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 2-chloro-4-nitropyridine |
| InChIKey | LIEPVGBDUYKPLC-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)