Products 2306195-65-1
CAS 2306195-65-1 appears in our catalog under these names: BA-53038B, BA–53038B, BA-53038B, 98.10%, 98.10%, BA-53038B, 98.73%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 2mg, 25mg, 50mg, 10mg, 5mg, 10mM (in 1ml dmso), 100 mg.
N-(3-chlorophenyl)bicyclo[4.1.0]heptane-7-carboxamide (CAS 2306195-65-1) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: N-(3-chlorophenyl)bicyclo[4.1.0]heptane-7-carboxamide. InChIKey: ZLCICHYECNOTGG-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | N-(3-chlorophenyl)bicyclo[4.1.0]heptane-7-carboxamide |
| InChIKey | ZLCICHYECNOTGG-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)C2C(=O)NC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)