CAS 2306244-79-9 appears in our catalog under these names: (3R,4R)-3-Fluoro-N,N-dimethylpiperidin-4-amine dihydrochloride, 97%, (3R,4R)-3-fluoro-N,N-dimethyl-piperidin-4-amine,dihydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
(3R,4R)-3-fluoro-N,N-dimethylpiperidin-4-amine;dihydrochloride (CAS 2306244-79-9) is a chemical compound with the molecular formula C7H17Cl2FN2 and a molecular weight of 219.12 g/mol. IUPAC name: (3R,4R)-3-fluoro-N,N-dimethylpiperidin-4-amine;dihydrochloride. InChIKey: NKPCYUMLEXPFIL-GPJOBVNKSA-N.
| Molecular formula | C7H17Cl2FN2 |
|---|---|
| Molecular weight | 219.12 g/mol |
| IUPAC name | (3R,4R)-3-fluoro-N,N-dimethylpiperidin-4-amine;dihydrochloride |
| InChIKey | NKPCYUMLEXPFIL-GPJOBVNKSA-N |
| SMILES | CN(C)[C@@H]1CCNC[C@H]1F.Cl.Cl |
Computed by PubChem (NCBI)