CAS 2306254-76-0 appears in our catalog under these names: (R)-1-(2-Fluoroethyl)piperidin-3-amine dihydrochloride, 97%, (3R)-1-(2-fluoroethyl)piperidin-3-amine,dihydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
(3R)-1-(2-fluoroethyl)piperidin-3-amine;dihydrochloride (CAS 2306254-76-0) is a chemical compound with the molecular formula C7H17Cl2FN2 and a molecular weight of 219.12 g/mol. IUPAC name: (3R)-1-(2-fluoroethyl)piperidin-3-amine;dihydrochloride. InChIKey: SATCBCKSMHVJTE-XCUBXKJBSA-N.
| Molecular formula | C7H17Cl2FN2 |
|---|---|
| Molecular weight | 219.12 g/mol |
| IUPAC name | (3R)-1-(2-fluoroethyl)piperidin-3-amine;dihydrochloride |
| InChIKey | SATCBCKSMHVJTE-XCUBXKJBSA-N |
| SMILES | C1C[C@H](CN(C1)CCF)N.Cl.Cl |
Computed by PubChem (NCBI)