Products 845256-64-6
CAS 845256-64-6 is the registry number for (3R,4S)-3-Fluoro-N,1-dimethylpiperidin-4-amine dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3R,4S)-3-fluoro-N,1-dimethylpiperidin-4-amine;dihydrochloride (CAS 845256-64-6) is a chemical compound with the molecular formula C7H17Cl2FN2 and a molecular weight of 219.12 g/mol. IUPAC name: (3R,4S)-3-fluoro-N,1-dimethylpiperidin-4-amine;dihydrochloride. InChIKey: JTARGOJRKGSZIB-VJBFUYBPSA-N.
| Molecular formula | C7H17Cl2FN2 |
|---|---|
| Molecular weight | 219.12 g/mol |
| IUPAC name | (3R,4S)-3-fluoro-N,1-dimethylpiperidin-4-amine;dihydrochloride |
| InChIKey | JTARGOJRKGSZIB-VJBFUYBPSA-N |
| SMILES | CN[C@H]1CCN(C[C@H]1F)C.Cl.Cl |
Computed by PubChem (NCBI)