CAS 2306246-82-0 is the registry number for tert-butyl (4-bromo-1-methyl-1H-pyrazol-3-yl)carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(3S,4S)-4-(difluoromethyl)pyrrolidin-3-yl]methanol;hydrochloride (CAS 2306246-82-0) is a chemical compound with the molecular formula C6H12ClF2NO and a molecular weight of 187.61 g/mol. IUPAC name: [(3S,4S)-4-(difluoromethyl)pyrrolidin-3-yl]methanol;hydrochloride. InChIKey: MQTHVRFUFUWJMA-UYXJWNHNSA-N.
| Molecular formula | C6H12ClF2NO |
|---|---|
| Molecular weight | 187.61 g/mol |
| IUPAC name | [(3S,4S)-4-(difluoromethyl)pyrrolidin-3-yl]methanol;hydrochloride |
| InChIKey | MQTHVRFUFUWJMA-UYXJWNHNSA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(F)F)CO.Cl |
Computed by PubChem (NCBI)