Products 2306247-62-9
CAS 2306247-62-9 is the registry number for tert-Butyl (1R,5R,6S)-6-hydroxy-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl (1R,5R,6S)-6-hydroxy-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2306247-62-9) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (1R,5R,6S)-6-hydroxy-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: CYRPCDFWLJRNBX-HLTSFMKQSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (1R,5R,6S)-6-hydroxy-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | CYRPCDFWLJRNBX-HLTSFMKQSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@@H]([C@H]1CNC2)O |
Computed by PubChem (NCBI)