CAS 2306248-50-8 appears in our catalog under these names: (3S,4S)-4-Fluoro-1-methylpiperidin-3-amine dihydrochloride, 97%, (3S,4S)-4-fluoro-1-methyl-piperidin-3-amine,dihydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(3S,4S)-4-fluoro-1-methylpiperidin-3-amine;dihydrochloride (CAS 2306248-50-8) is a chemical compound with the molecular formula C6H15Cl2FN2 and a molecular weight of 205.10 g/mol. IUPAC name: (3S,4S)-4-fluoro-1-methylpiperidin-3-amine;dihydrochloride. InChIKey: HPGKUKNSIJKZDA-USPAICOZSA-N.
| Molecular formula | C6H15Cl2FN2 |
|---|---|
| Molecular weight | 205.10 g/mol |
| IUPAC name | (3S,4S)-4-fluoro-1-methylpiperidin-3-amine;dihydrochloride |
| InChIKey | HPGKUKNSIJKZDA-USPAICOZSA-N |
| SMILES | CN1CC[C@@H]([C@H](C1)N)F.Cl.Cl |
Computed by PubChem (NCBI)