CAS 2913572-95-7 is the registry number for (3R,5R)-5-Fluoro-1-methylpiperidin-3-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5R)-5-fluoro-1-methylpiperidin-3-amine;dihydrochloride (CAS 2913572-95-7) is a chemical compound with the molecular formula C6H15Cl2FN2 and a molecular weight of 205.10 g/mol. IUPAC name: (3R,5R)-5-fluoro-1-methylpiperidin-3-amine;dihydrochloride. InChIKey: OCCHKNZOQOYMIG-BNTLRKBRSA-N.
| Molecular formula | C6H15Cl2FN2 |
|---|---|
| Molecular weight | 205.10 g/mol |
| IUPAC name | (3R,5R)-5-fluoro-1-methylpiperidin-3-amine;dihydrochloride |
| InChIKey | OCCHKNZOQOYMIG-BNTLRKBRSA-N |
| SMILES | CN1C[C@@H](C[C@H](C1)F)N.Cl.Cl |
Computed by PubChem (NCBI)