Products 2913574-62-4
CAS 2913574-62-4 appears in our catalog under these names: (3R,5R)-5-Fluoro-1-methylpiperidin-3-amine dihydrochloride, 98%, (3R,5R)-5-Fluoro-1-methylpiperidin-3-amine dihydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
(3R,5R)-5-fluoro-1-methylpiperidin-3-amine;dihydrochloride (CAS 2913574-62-4) is a chemical compound with the molecular formula C6H15Cl2FN2 and a molecular weight of 205.10 g/mol. IUPAC name: (3R,5R)-5-fluoro-1-methylpiperidin-3-amine;dihydrochloride. InChIKey: OCCHKNZOQOYMIG-BNTLRKBRSA-N.
| Molecular formula | C6H15Cl2FN2 |
|---|---|
| Molecular weight | 205.10 g/mol |
| IUPAC name | (3R,5R)-5-fluoro-1-methylpiperidin-3-amine;dihydrochloride |
| InChIKey | OCCHKNZOQOYMIG-BNTLRKBRSA-N |
| SMILES | CN1C[C@@H](C[C@H](C1)F)N.Cl.Cl |
Computed by PubChem (NCBI)